C24H27NO5 — CID 42903813
(7-methyl-2-oxochromen-4-yl)methyl 3-acetamidoadamantane-1-carboxylate (PubChem CID 42903813) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 3-acetamidoadamantane-1-carboxylate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 3-acetamidoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 42903813 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 3-acetamidoadamantane-1-carboxylate |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C(=O)OCc1cc(=O)oc4cc(C)ccc14)(C3)C2 |
| InChI | InChI=1S/C24H27NO5/c1-14-3-4-19-18(7-21(27)30-20(19)5-14)12-29-22(28)23-8-16-6-17(9-23)11-24(10-16,13-23)25-15(2)26/h3-5,7,16-17H,6,8-13H2,1-2H3,(H,25,26) |
| InChIKey | CVGGUYTXZKVRCI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|