C22H27N3O6 — CID 55328166
[2-(4-methyl-2-nitroanilino)-2-oxoethyl] 3-acetamidoadamantane-1-carboxylate (PubChem CID 55328166) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 3-acetamidoadamantane-1-carboxylate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 3-acetamidoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 55328166 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 3-acetamidoadamantane-1-carboxylate |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C(=O)OCC(=O)Nc1ccc(C)cc1[N+](=O)[O-])(C3)C2 |
| InChI | InChI=1S/C22H27N3O6/c1-13-3-4-17(18(5-13)25(29)30)23-19(27)11-31-20(28)21-7-15-6-16(8-21)10-22(9-15,12-21)24-14(2)26/h3-5,15-16H,6-12H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | PKVXQNXRMNEZCJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|