C22H29NO3 — CID 55328213
(2,5-dimethylphenyl)methyl 3-acetamidoadamantane-1-carboxylate (PubChem CID 55328213) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl 3-acetamidoadamantane-1-carboxylate.
| Compound Name | (2,5-dimethylphenyl)methyl 3-acetamidoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 55328213 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (2,5-dimethylphenyl)methyl 3-acetamidoadamantane-1-carboxylate |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C(=O)OCc1cc(C)ccc1C)(C3)C2 |
| InChI | InChI=1S/C22H29NO3/c1-14-4-5-15(2)19(6-14)12-26-20(25)21-8-17-7-18(9-21)11-22(10-17,13-21)23-16(3)24/h4-6,17-18H,7-13H2,1-3H3,(H,23,24) |
| InChIKey | QPYSCTNAIVKIJX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |