C20H27NO — CID 92682215
N-(1-adamantyl)-2-(2,5-dimethylphenyl)acetamide (PubChem CID 92682215) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(2,5-dimethylphenyl)acetamide.
| Compound Name | N-(1-adamantyl)-2-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 92682215 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-(1-adamantyl)-2-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(CC(=O)NC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H27NO/c1-13-3-4-14(2)18(5-13)9-19(22)21-20-10-15-6-16(11-20)8-17(7-15)12-20/h3-5,15-17H,6-12H2,1-2H3,(H,21,22) |
| InChIKey | POJBFWNWQYPWBY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |