C22H33N3O3S — CID 92663910
N-(1-adamantyl)-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide (PubChem CID 92663910) has the molecular formula C22H33N3O3S and a molecular weight of 419.59 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide.
| Compound Name | N-(1-adamantyl)-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide |
|---|---|
| PubChem CID | 92663910 |
| Molecular Formula | C22H33N3O3S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-(1-adamantyl)-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide |
| SMILES | Cc1ccc(C)c(N(CC(=O)NC23CC4CC(CC(C4)C2)C3)S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C22H33N3O3S/c1-15-5-6-16(2)20(7-15)25(29(27,28)24(3)4)14-21(26)23-22-11-17-8-18(12-22)10-19(9-17)13-22/h5-7,17-19H,8-14H2,1-4H3,(H,23,26) |
| InChIKey | QRLOOSJAKIQENV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |