C18H31N3O3S2 — CID 53282024
N-(2-tert-butylsulfanylethyl)-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide (PubChem CID 53282024) has the molecular formula C18H31N3O3S2 and a molecular weight of 401.60 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide |
|---|---|
| PubChem CID | 53282024 |
| Molecular Formula | C18H31N3O3S2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide |
| SMILES | Cc1ccc(C)c(N(CC(=O)NCCSC(C)(C)C)S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H31N3O3S2/c1-14-8-9-15(2)16(12-14)21(26(23,24)20(6)7)13-17(22)19-10-11-25-18(3,4)5/h8-9,12H,10-11,13H2,1-7H3,(H,19,22) |
| InChIKey | IPUSCKBXSSHNPH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|