C16H27N3O3S — CID 53282051
N-butyl-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide (PubChem CID 53282051) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is N-butyl-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide.
| Compound Name | N-butyl-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide |
|---|---|
| PubChem CID | 53282051 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-butyl-2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetamide |
| SMILES | CCCCNC(=O)CN(c1cc(C)ccc1C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C16H27N3O3S/c1-6-7-10-17-16(20)12-19(23(21,22)18(4)5)15-11-13(2)8-9-14(15)3/h8-9,11H,6-7,10,12H2,1-5H3,(H,17,20) |
| InChIKey | ZGJCKZKCPSIRKS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|