C27H40N4O4S — CID 132730045
2-[benzyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]-N-butylbutanamide (PubChem CID 132730045) has the molecular formula C27H40N4O4S and a molecular weight of 516.71 g/mol. Its IUPAC name is 2-[benzyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]-N-butylbutanamide.
| Compound Name | 2-[benzyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132730045 |
| Molecular Formula | C27H40N4O4S |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 2-[benzyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1)C(=O)CN(c1cc(C)ccc1C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C27H40N4O4S/c1-7-9-17-28-27(33)24(8-2)30(19-23-13-11-10-12-14-23)26(32)20-31(36(34,35)29(5)6)25-18-21(3)15-16-22(25)4/h10-16,18,24H,7-9,17,19-20H2,1-6H3,(H,28,33) |
| InChIKey | ZKXQLPCMBNXLDQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|