C27H38Cl2N4O4S — CID 132747106
N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]butanamide (PubChem CID 132747106) has the molecular formula C27H38Cl2N4O4S and a molecular weight of 585.60 g/mol. Its IUPAC name is N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132747106 |
| Molecular Formula | C27H38Cl2N4O4S |
| Molecular Weight | 585.60 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1cc(C)ccc1C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C27H38Cl2N4O4S/c1-7-9-14-30-27(35)24(8-2)32(17-21-12-13-22(28)16-23(21)29)26(34)18-33(38(36,37)31(5)6)25-15-19(3)10-11-20(25)4/h10-13,15-16,24H,7-9,14,17-18H2,1-6H3,(H,30,35) |
| InChIKey | ICWGKVOCPMBOHW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|