C28H42N4O4S — CID 132733726
N-butyl-2-[[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]-[(4-methylphenyl)methyl]amino]butanamide (PubChem CID 132733726) has the molecular formula C28H42N4O4S and a molecular weight of 530.74 g/mol. Its IUPAC name is N-butyl-2-[[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]-[(4-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]-[(4-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132733726 |
| Molecular Formula | C28H42N4O4S |
| Molecular Weight | 530.74 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | N-butyl-2-[[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]-[(4-methylphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(C)cc1)C(=O)CN(c1cc(C)ccc1C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C28H42N4O4S/c1-8-10-17-29-28(34)25(9-2)31(19-24-15-12-21(3)13-16-24)27(33)20-32(37(35,36)30(6)7)26-18-22(4)11-14-23(26)5/h11-16,18,25H,8-10,17,19-20H2,1-7H3,(H,29,34) |
| InChIKey | NGYCTGQYQWFEFK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.74 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|