C26H37ClN4O4S — CID 132735363
N-butyl-2-[(2-chlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]propanamide (PubChem CID 132735363) has the molecular formula C26H37ClN4O4S and a molecular weight of 537.13 g/mol. Its IUPAC name is N-butyl-2-[(2-chlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(2-chlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132735363 |
| Molecular Formula | C26H37ClN4O4S |
| Molecular Weight | 537.13 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | N-butyl-2-[(2-chlorophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccccc1Cl)C(=O)CN(c1cc(C)ccc1C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C26H37ClN4O4S/c1-7-8-15-28-26(33)21(4)30(17-22-11-9-10-12-23(22)27)25(32)18-31(36(34,35)29(5)6)24-16-19(2)13-14-20(24)3/h9-14,16,21H,7-8,15,17-18H2,1-6H3,(H,28,33) |
| InChIKey | LGQUDFWVOVHPDC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.13 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|