C32H41BrN4O4S — CID 100669254
(2R)-2-[(3-bromophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100669254) has the molecular formula C32H41BrN4O4S and a molecular weight of 657.68 g/mol. Its IUPAC name is (2R)-2-[(3-bromophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3-bromophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100669254 |
| Molecular Formula | C32H41BrN4O4S |
| Molecular Weight | 657.68 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | (2R)-2-[(3-bromophenyl)methyl-[2-[N-(dimethylsulfamoyl)-2,5-dimethylanilino]acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CN(c1cc(C)ccc1C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C32H41BrN4O4S/c1-6-7-18-34-32(39)30(21-26-12-9-8-10-13-26)36(22-27-14-11-15-28(33)20-27)31(38)23-37(42(40,41)35(4)5)29-19-24(2)16-17-25(29)3/h8-17,19-20,30H,6-7,18,21-23H2,1-5H3,(H,34,39)/t30-/m1/s1 |
| InChIKey | SRYZYOQZZKJWAW-SSEXGKCCSA-N |
| XLogP | 5.24 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|