C22H32N2O — CID 9045207
N-(1-adamantyl)-2-[(2,4-dimethylphenyl)methyl-methylamino]acetamide (PubChem CID 9045207) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[(2,4-dimethylphenyl)methyl-methylamino]acetamide.
| Compound Name | N-(1-adamantyl)-2-[(2,4-dimethylphenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 9045207 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | N-(1-adamantyl)-2-[(2,4-dimethylphenyl)methyl-methylamino]acetamide |
| SMILES | Cc1ccc(CN(C)CC(=O)NC23CC4CC(CC(C4)C2)C3)c(C)c1 |
| InChI | InChI=1S/C22H32N2O/c1-15-4-5-20(16(2)6-15)13-24(3)14-21(25)23-22-10-17-7-18(11-22)9-19(8-17)12-22/h4-6,17-19H,7-14H2,1-3H3,(H,23,25) |
| InChIKey | QCVLCSLRSKFKAV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |