C20H28N2O — CID 3556406
N-(1-adamantyl)-2-[benzyl(methyl)amino]acetamide (PubChem CID 3556406) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[benzyl(methyl)amino]acetamide.
| Compound Name | N-(1-adamantyl)-2-[benzyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 3556406 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | N-(1-adamantyl)-2-[benzyl(methyl)amino]acetamide |
| SMILES | CN(CC(=O)NC12CC3CC(CC(C3)C1)C2)Cc1ccccc1 |
| InChI | InChI=1S/C20H28N2O/c1-22(13-15-5-3-2-4-6-15)14-19(23)21-20-10-16-7-17(11-20)9-18(8-16)12-20/h2-6,16-18H,7-14H2,1H3,(H,21,23) |
| InChIKey | VXLGDQDGDHTHER-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |