C22H31N3O2 — CID 9346080
(2R)-N-(1-adamantylcarbamoyl)-2-[benzyl(methyl)amino]propanamide (PubChem CID 9346080) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is (2R)-N-(1-adamantylcarbamoyl)-2-[benzyl(methyl)amino]propanamide.
| Compound Name | (2R)-N-(1-adamantylcarbamoyl)-2-[benzyl(methyl)amino]propanamide |
|---|---|
| PubChem CID | 9346080 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (2R)-N-(1-adamantylcarbamoyl)-2-[benzyl(methyl)amino]propanamide |
| SMILES | C[C@H](C(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C22H31N3O2/c1-15(25(2)14-16-6-4-3-5-7-16)20(26)23-21(27)24-22-11-17-8-18(12-22)10-19(9-17)13-22/h3-7,15,17-19H,8-14H2,1-2H3,(H2,23,24,26,27)/t15-,17?,18?,19?,22?/m1/s1 |
| InChIKey | DDLFYDQCNLLDSV-VZLUNSFSSA-N |
| XLogP | 3.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |