C20H29N3O3 — CID 9348849
(2S)-N-(1-adamantylcarbamoyl)-2-[furan-2-ylmethyl(methyl)amino]propanamide (PubChem CID 9348849) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (2S)-N-(1-adamantylcarbamoyl)-2-[furan-2-ylmethyl(methyl)amino]propanamide.
| Compound Name | (2S)-N-(1-adamantylcarbamoyl)-2-[furan-2-ylmethyl(methyl)amino]propanamide |
|---|---|
| PubChem CID | 9348849 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (2S)-N-(1-adamantylcarbamoyl)-2-[furan-2-ylmethyl(methyl)amino]propanamide |
| SMILES | C[C@@H](C(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2)N(C)Cc1ccco1 |
| InChI | InChI=1S/C20H29N3O3/c1-13(23(2)12-17-4-3-5-26-17)18(24)21-19(25)22-20-9-14-6-15(10-20)8-16(7-14)11-20/h3-5,13-16H,6-12H2,1-2H3,(H2,21,22,24,25)/t13-,14?,15?,16?,20?/m0/s1 |
| InChIKey | RIBDDTKFYAPRIK-IVKJLDKCSA-N |
| XLogP | 2.89 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |