C23H29N3O3S — CID 8678198
N-(1-adamantylcarbamoyl)-2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetamide (PubChem CID 8678198) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is N-(1-adamantylcarbamoyl)-2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetamide.
| Compound Name | N-(1-adamantylcarbamoyl)-2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 8678198 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-(1-adamantylcarbamoyl)-2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetamide |
| SMILES | O=C(CN(Cc1ccco1)Cc1cccs1)NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H29N3O3S/c27-21(15-26(13-19-3-1-5-29-19)14-20-4-2-6-30-20)24-22(28)25-23-10-16-7-17(11-23)9-18(8-16)12-23/h1-6,16-18H,7-15H2,(H2,24,25,27,28) |
| InChIKey | QYHBMGTUPQULQX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |