C24H27N3O3S — CID 17449333
N-cyclopentyl-2-[[2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide (PubChem CID 17449333) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17449333 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-cyclopentyl-2-[[2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide |
| SMILES | O=C(CN(Cc1ccco1)Cc1cccs1)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C24H27N3O3S/c28-23(17-27(15-19-9-5-13-30-19)16-20-10-6-14-31-20)26-22-12-4-3-11-21(22)24(29)25-18-7-1-2-8-18/h3-6,9-14,18H,1-2,7-8,15-17H2,(H,25,29)(H,26,28) |
| InChIKey | WKZOXPBOXJVTTP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |