C21H21N3O3S — CID 24664133
N-cyclopentyl-2-[[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]amino]benzamide (PubChem CID 24664133) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 24664133 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-cyclopentyl-2-[[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]amino]benzamide |
| SMILES | O=C(Cc1csc(-c2ccco2)n1)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C21H21N3O3S/c25-19(12-15-13-28-21(23-15)18-10-5-11-27-18)24-17-9-4-3-8-16(17)20(26)22-14-6-1-2-7-14/h3-5,8-11,13-14H,1-2,6-7,12H2,(H,22,26)(H,24,25) |
| InChIKey | UKWZBMFBNQXKIA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |