C16H20N2O2S — CID 46578282
2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-(2-methylcyclohexyl)acetamide (PubChem CID 46578282) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-(2-methylcyclohexyl)acetamide.
| Compound Name | 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-(2-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 46578282 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-(2-methylcyclohexyl)acetamide |
| SMILES | CC1CCCCC1NC(=O)Cc1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C16H20N2O2S/c1-11-5-2-3-6-13(11)18-15(19)9-12-10-21-16(17-12)14-7-4-8-20-14/h4,7-8,10-11,13H,2-3,5-6,9H2,1H3,(H,18,19) |
| InChIKey | RUOIIQARAMGQOR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |