C14H22N4OS2 — CID 8746786
1-[(1R,2S)-2-methylcyclohexyl]-3-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]thiourea (PubChem CID 8746786) has the molecular formula C14H22N4OS2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 1-[(1R,2S)-2-methylcyclohexyl]-3-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]thiourea.
| Compound Name | 1-[(1R,2S)-2-methylcyclohexyl]-3-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8746786 |
| Molecular Formula | C14H22N4OS2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-[(1R,2S)-2-methylcyclohexyl]-3-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]thiourea |
| SMILES | Cc1nc(CC(=O)NNC(=S)N[C@@H]2CCCC[C@@H]2C)cs1 |
| InChI | InChI=1S/C14H22N4OS2/c1-9-5-3-4-6-12(9)16-14(20)18-17-13(19)7-11-8-21-10(2)15-11/h8-9,12H,3-7H2,1-2H3,(H,17,19)(H2,16,18,20)/t9-,12+/m0/s1 |
| InChIKey | KFWRNLRQHZADCA-JOYOIKCWSA-N |
| XLogP | 2.07 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|