C9H14N4OS2 — CID 8746565
1-ethyl-3-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]thiourea (PubChem CID 8746565) has the molecular formula C9H14N4OS2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 1-ethyl-3-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]thiourea.
| Compound Name | 1-ethyl-3-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8746565 |
| Molecular Formula | C9H14N4OS2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-ethyl-3-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]thiourea |
| SMILES | CCNC(=S)NNC(=O)Cc1csc(C)n1 |
| InChI | InChI=1S/C9H14N4OS2/c1-3-10-9(15)13-12-8(14)4-7-5-16-6(2)11-7/h5H,3-4H2,1-2H3,(H,12,14)(H2,10,13,15) |
| InChIKey | ZGTQSBNYFQJXKA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|