C7H10N2O2S — CID 60716850
N-methoxy-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 60716850) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is N-methoxy-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-methoxy-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 60716850 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | N-methoxy-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | CONC(=O)Cc1csc(C)n1 |
| InChI | InChI=1S/C7H10N2O2S/c1-5-8-6(4-12-5)3-7(10)9-11-2/h4H,3H2,1-2H3,(H,9,10) |
| InChIKey | CHCUADLCDHVQIT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|