C10H16N2O3S — CID 110463239
N-(2,2-dimethoxyethyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 110463239) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 110463239 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | COC(CNC(=O)Cc1csc(C)n1)OC |
| InChI | InChI=1S/C10H16N2O3S/c1-7-12-8(6-16-7)4-9(13)11-5-10(14-2)15-3/h6,10H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | LJTDDRGGCJZAIX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|