C13H18N2O5S — CID 43409386
diethyl 2-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]propanedioate (PubChem CID 43409386) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is diethyl 2-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]propanedioate.
| Compound Name | diethyl 2-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]propanedioate |
|---|---|
| PubChem CID | 43409386 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | diethyl 2-[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)Cc1csc(C)n1)C(=O)OCC |
| InChI | InChI=1S/C13H18N2O5S/c1-4-19-12(17)11(13(18)20-5-2)15-10(16)6-9-7-21-8(3)14-9/h7,11H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | CHFJJVWYHIEFRA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|