C16H20N2O2S — CID 97215731
2-(2-methyl-1,3-thiazol-4-yl)-N-[(2S,3S)-3-phenoxybutan-2-yl]acetamide (PubChem CID 97215731) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-N-[(2S,3S)-3-phenoxybutan-2-yl]acetamide.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[(2S,3S)-3-phenoxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 97215731 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[(2S,3S)-3-phenoxybutan-2-yl]acetamide |
| SMILES | Cc1nc(CC(=O)N[C@@H](C)[C@H](C)Oc2ccccc2)cs1 |
| InChI | InChI=1S/C16H20N2O2S/c1-11(12(2)20-15-7-5-4-6-8-15)17-16(19)9-14-10-21-13(3)18-14/h4-8,10-12H,9H2,1-3H3,(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | AXMUOALXLZHUAK-RYUDHWBXSA-N |
| XLogP | 2.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |