C11H17NO3S — CID 79495928
1,1-diethoxy-3-(2-methyl-1,3-thiazol-4-yl)propan-2-one (PubChem CID 79495928) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 1,1-diethoxy-3-(2-methyl-1,3-thiazol-4-yl)propan-2-one.
| Compound Name | 1,1-diethoxy-3-(2-methyl-1,3-thiazol-4-yl)propan-2-one |
|---|---|
| PubChem CID | 79495928 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1,1-diethoxy-3-(2-methyl-1,3-thiazol-4-yl)propan-2-one |
| SMILES | CCOC(OCC)C(=O)Cc1csc(C)n1 |
| InChI | InChI=1S/C11H17NO3S/c1-4-14-11(15-5-2)10(13)6-9-7-16-8(3)12-9/h7,11H,4-6H2,1-3H3 |
| InChIKey | YYGFHCSCMZCXQU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|