C8H12N2OS — CID 62798653
ethyl 2-(2-methyl-1,3-thiazol-4-yl)ethanimidate (PubChem CID 62798653) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is ethyl 2-(2-methyl-1,3-thiazol-4-yl)ethanimidate.
| Compound Name | ethyl 2-(2-methyl-1,3-thiazol-4-yl)ethanimidate |
|---|---|
| PubChem CID | 62798653 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | ethyl 2-(2-methyl-1,3-thiazol-4-yl)ethanimidate |
| SMILES | [H]/N=C(/Cc1csc(C)n1)OCC |
| InChI | InChI=1S/C8H12N2OS/c1-3-11-8(9)4-7-5-12-6(2)10-7/h5,9H,3-4H2,1-2H3/b9-8- |
| InChIKey | OPPVCOHRNOLZRJ-HJWRWDBZSA-N |
| XLogP | 2.01 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|