C11H18N2O2S — CID 116593839
3-amino-6-methoxy-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-one (PubChem CID 116593839) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 3-amino-6-methoxy-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-one.
| Compound Name | 3-amino-6-methoxy-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-one |
|---|---|
| PubChem CID | 116593839 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-amino-6-methoxy-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-one |
| SMILES | COCCCC(N)C(=O)Cc1csc(C)n1 |
| InChI | InChI=1S/C11H18N2O2S/c1-8-13-9(7-16-8)6-11(14)10(12)4-3-5-15-2/h7,10H,3-6,12H2,1-2H3 |
| InChIKey | LOWMRBVJMNKIFT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|