C11H20N4O2 — CID 116593803
3-amino-1-(2-ethyl-1,2,4-triazol-3-yl)-6-methoxyhexan-2-one (PubChem CID 116593803) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-amino-1-(2-ethyl-1,2,4-triazol-3-yl)-6-methoxyhexan-2-one.
| Compound Name | 3-amino-1-(2-ethyl-1,2,4-triazol-3-yl)-6-methoxyhexan-2-one |
|---|---|
| PubChem CID | 116593803 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3-amino-1-(2-ethyl-1,2,4-triazol-3-yl)-6-methoxyhexan-2-one |
| SMILES | CCn1ncnc1CC(=O)C(N)CCCOC |
| InChI | InChI=1S/C11H20N4O2/c1-3-15-11(13-8-14-15)7-10(16)9(12)5-4-6-17-2/h8-9H,3-7,12H2,1-2H3 |
| InChIKey | YUKYUNRTHRZRQS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|