C13H23N3O — CID 115779150
1-(2-ethyl-1,2,4-triazol-3-yl)-3-propylhexan-2-one (PubChem CID 115779150) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-(2-ethyl-1,2,4-triazol-3-yl)-3-propylhexan-2-one.
| Compound Name | 1-(2-ethyl-1,2,4-triazol-3-yl)-3-propylhexan-2-one |
|---|---|
| PubChem CID | 115779150 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 1-(2-ethyl-1,2,4-triazol-3-yl)-3-propylhexan-2-one |
| SMILES | CCCC(CCC)C(=O)Cc1ncnn1CC |
| InChI | InChI=1S/C13H23N3O/c1-4-7-11(8-5-2)12(17)9-13-14-10-15-16(13)6-3/h10-11H,4-9H2,1-3H3 |
| InChIKey | FPQHWKHKSZKXNW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |