C12H11Br2N3O — CID 114023198
1-(3,5-dibromophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethanone (PubChem CID 114023198) has the molecular formula C12H11Br2N3O and a molecular weight of 373.05 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethanone.
| Compound Name | 1-(3,5-dibromophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethanone |
|---|---|
| PubChem CID | 114023198 |
| Molecular Formula | C12H11Br2N3O |
| Molecular Weight | 373.05 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 1-(3,5-dibromophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethanone |
| SMILES | CCn1ncnc1CC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C12H11Br2N3O/c1-2-17-12(15-7-16-17)6-11(18)8-3-9(13)5-10(14)4-8/h3-5,7H,2,6H2,1H3 |
| InChIKey | QFSJOAKDBNMZLP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.05 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |