C5H9N3O — CID 11412385
(2-ethyl-1,2,4-triazol-3-yl)methanol (PubChem CID 11412385) has the molecular formula C5H9N3O and a molecular weight of 127.15 g/mol. Its IUPAC name is (2-ethyl-1,2,4-triazol-3-yl)methanol.
| Compound Name | (2-ethyl-1,2,4-triazol-3-yl)methanol |
|---|---|
| PubChem CID | 11412385 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | (2-ethyl-1,2,4-triazol-3-yl)methanol |
| SMILES | CCn1ncnc1CO |
| InChI | InChI=1S/C5H9N3O/c1-2-8-5(3-9)6-4-7-8/h4,9H,2-3H2,1H3 |
| InChIKey | ZQYXCGFXZPLEKX-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |