About [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol
[3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol (PubChem CID 66349523) has the molecular formula C12H15N3OS
and a molecular weight of 249.34 g/mol. Its IUPAC name is [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol.
Molecular Properties
| Compound Name | [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol |
| PubChem CID | 66349523 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol |
| SMILES | CCn1ncnc1CSc1cccc(CO)c1 |
| InChI | InChI=1S/C12H15N3OS/c1-2-15-12(13-9-14-15)8-17-11-5-3-4-10(6-11)7-16/h3-6,9,16H,2,7-8H2,1H3 |
| InChIKey | FVBJPRHLXPJOID-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol?
The IUPAC name of [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol (CID 66349523) is [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol.
What is the SMILES notation for [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol?
The canonical SMILES for [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol is CCn1ncnc1CSc1cccc(CO)c1.
What is the InChIKey of [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol?
The InChIKey is FVBJPRHLXPJOID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3OS/c1-2-15-12(13-9-14-15)8-17-11-5-3-4-10(6-11)7-16/h3-6,9,16H,2,7-8H2,1H3.
What are the key properties of [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol?
[3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol has a molecular weight of 249.34 g/mol, XLogP of 2.08, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]phenyl]methanol is sourced from PubChem (CID 66349523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).