C11H14N4S — CID 79133781
3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline (PubChem CID 79133781) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline.
| Compound Name | 3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79133781 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline |
| SMILES | CCn1ncnc1CSc1cccc(N)c1 |
| InChI | InChI=1S/C11H14N4S/c1-2-15-11(13-8-14-15)7-16-10-5-3-4-9(12)6-10/h3-6,8H,2,7,12H2,1H3 |
| InChIKey | HQQZKKIKULSJQS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|