C11H13FN4S — CID 79148048
2-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]-4-fluoroaniline (PubChem CID 79148048) has the molecular formula C11H13FN4S and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]-4-fluoroaniline.
| Compound Name | 2-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 79148048 |
| Molecular Formula | C11H13FN4S |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-[(2-ethyl-1,2,4-triazol-3-yl)methylsulfanyl]-4-fluoroaniline |
| SMILES | CCn1ncnc1CSc1cc(F)ccc1N |
| InChI | InChI=1S/C11H13FN4S/c1-2-16-11(14-7-15-16)6-17-10-5-8(12)3-4-9(10)13/h3-5,7H,2,6,13H2,1H3 |
| InChIKey | RJGMTAFFRHDVGY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|