C10H11ClN4S — CID 79528483
4-chloro-2-[(2-methyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline (PubChem CID 79528483) has the molecular formula C10H11ClN4S and a molecular weight of 254.75 g/mol. Its IUPAC name is 4-chloro-2-[(2-methyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline.
| Compound Name | 4-chloro-2-[(2-methyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79528483 |
| Molecular Formula | C10H11ClN4S |
| Molecular Weight | 254.75 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 4-chloro-2-[(2-methyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline |
| SMILES | Cn1ncnc1CSc1cc(Cl)ccc1N |
| InChI | InChI=1S/C10H11ClN4S/c1-15-10(13-6-14-15)5-16-9-4-7(11)2-3-8(9)12/h2-4,6H,5,12H2,1H3 |
| InChIKey | SYFLZMISXTYULL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|