C11H14N4S — CID 79141423
4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline (PubChem CID 79141423) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline.
| Compound Name | 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79141423 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methylsulfanyl]aniline |
| SMILES | Cc1ccc(N)cc1SCc1ncnn1C |
| InChI | InChI=1S/C11H14N4S/c1-8-3-4-9(12)5-10(8)16-6-11-13-7-14-15(11)2/h3-5,7H,6,12H2,1-2H3 |
| InChIKey | CSLBVEZTJIEOPH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|