C12H9Cl3N2S — CID 116519589
4-chloro-2-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]aniline (PubChem CID 116519589) has the molecular formula C12H9Cl3N2S and a molecular weight of 319.64 g/mol. Its IUPAC name is 4-chloro-2-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]aniline.
| Compound Name | 4-chloro-2-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 116519589 |
| Molecular Formula | C12H9Cl3N2S |
| Molecular Weight | 319.64 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 4-chloro-2-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]aniline |
| SMILES | Nc1ccc(Cl)cc1SCc1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl3N2S/c13-8-1-2-10(16)11(3-8)18-6-7-5-17-12(15)4-9(7)14/h1-5H,6,16H2 |
| InChIKey | IQODIVMHMDXDDS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|