C13H8Cl2FNO2S — CID 116518727
5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-2-fluorobenzoic acid (PubChem CID 116518727) has the molecular formula C13H8Cl2FNO2S and a molecular weight of 332.18 g/mol. Its IUPAC name is 5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-2-fluorobenzoic acid.
| Compound Name | 5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 116518727 |
| Molecular Formula | C13H8Cl2FNO2S |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(SCc2cnc(Cl)cc2Cl)ccc1F |
| InChI | InChI=1S/C13H8Cl2FNO2S/c14-10-4-12(15)17-5-7(10)6-20-8-1-2-11(16)9(3-8)13(18)19/h1-5H,6H2,(H,18,19) |
| InChIKey | FTFVSVZMEAURSA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|