C14H9ClF2O2S — CID 102670294
3-chloro-4-[(3,4-difluorophenyl)sulfanylmethyl]benzoic acid (PubChem CID 102670294) has the molecular formula C14H9ClF2O2S and a molecular weight of 314.74 g/mol. Its IUPAC name is 3-chloro-4-[(3,4-difluorophenyl)sulfanylmethyl]benzoic acid.
| Compound Name | 3-chloro-4-[(3,4-difluorophenyl)sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 102670294 |
| Molecular Formula | C14H9ClF2O2S |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 3-chloro-4-[(3,4-difluorophenyl)sulfanylmethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CSc2ccc(F)c(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C14H9ClF2O2S/c15-11-5-8(14(18)19)1-2-9(11)7-20-10-3-4-12(16)13(17)6-10/h1-6H,7H2,(H,18,19) |
| InChIKey | ILFAQMWNHHXVJM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |