C10H11ClN4OS — CID 81176456
5-chloro-2-[(2-methyl-1,2,4-triazol-3-yl)methylsulfinyl]aniline (PubChem CID 81176456) has the molecular formula C10H11ClN4OS and a molecular weight of 270.75 g/mol. Its IUPAC name is 5-chloro-2-[(2-methyl-1,2,4-triazol-3-yl)methylsulfinyl]aniline.
| Compound Name | 5-chloro-2-[(2-methyl-1,2,4-triazol-3-yl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 81176456 |
| Molecular Formula | C10H11ClN4OS |
| Molecular Weight | 270.75 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 5-chloro-2-[(2-methyl-1,2,4-triazol-3-yl)methylsulfinyl]aniline |
| SMILES | Cn1ncnc1CS(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C10H11ClN4OS/c1-15-10(13-6-14-15)5-17(16)9-3-2-7(11)4-8(9)12/h2-4,6H,5,12H2,1H3 |
| InChIKey | SDEWSDZHYDHIKZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.75 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|