C12H18ClNOS — CID 81175330
5-chloro-2-(3,3-dimethylbutylsulfinyl)aniline (PubChem CID 81175330) has the molecular formula C12H18ClNOS and a molecular weight of 259.80 g/mol. Its IUPAC name is 5-chloro-2-(3,3-dimethylbutylsulfinyl)aniline.
| Compound Name | 5-chloro-2-(3,3-dimethylbutylsulfinyl)aniline |
|---|---|
| PubChem CID | 81175330 |
| Molecular Formula | C12H18ClNOS |
| Molecular Weight | 259.80 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 5-chloro-2-(3,3-dimethylbutylsulfinyl)aniline |
| SMILES | CC(C)(C)CCS(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C12H18ClNOS/c1-12(2,3)6-7-16(15)11-5-4-9(13)8-10(11)14/h4-5,8H,6-7,14H2,1-3H3 |
| InChIKey | AKBXIIBAVIKKIQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|