C8H8ClF2NOS — CID 81175816
5-chloro-2-(2,2-difluoroethylsulfinyl)aniline (PubChem CID 81175816) has the molecular formula C8H8ClF2NOS and a molecular weight of 239.67 g/mol. Its IUPAC name is 5-chloro-2-(2,2-difluoroethylsulfinyl)aniline.
| Compound Name | 5-chloro-2-(2,2-difluoroethylsulfinyl)aniline |
|---|---|
| PubChem CID | 81175816 |
| Molecular Formula | C8H8ClF2NOS |
| Molecular Weight | 239.67 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 5-chloro-2-(2,2-difluoroethylsulfinyl)aniline |
| SMILES | Nc1cc(Cl)ccc1S(=O)CC(F)F |
| InChI | InChI=1S/C8H8ClF2NOS/c9-5-1-2-7(6(12)3-5)14(13)4-8(10)11/h1-3,8H,4,12H2 |
| InChIKey | CXWKOHHWCXXRCF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.67 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|