C8H8F3NOS — CID 81190420
4-(2,2-difluoroethylsulfinyl)-2-fluoroaniline (PubChem CID 81190420) has the molecular formula C8H8F3NOS and a molecular weight of 223.22 g/mol. Its IUPAC name is 4-(2,2-difluoroethylsulfinyl)-2-fluoroaniline.
| Compound Name | 4-(2,2-difluoroethylsulfinyl)-2-fluoroaniline |
|---|---|
| PubChem CID | 81190420 |
| Molecular Formula | C8H8F3NOS |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 4-(2,2-difluoroethylsulfinyl)-2-fluoroaniline |
| SMILES | Nc1ccc(S(=O)CC(F)F)cc1F |
| InChI | InChI=1S/C8H8F3NOS/c9-6-3-5(1-2-7(6)12)14(13)4-8(10)11/h1-3,8H,4,12H2 |
| InChIKey | MMVBIFCUCNVUTD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|