C11H15FN2O2S — CID 81190997
3-(4-amino-3-fluorophenyl)sulfinyl-N,N-dimethylpropanamide (PubChem CID 81190997) has the molecular formula C11H15FN2O2S and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-(4-amino-3-fluorophenyl)sulfinyl-N,N-dimethylpropanamide.
| Compound Name | 3-(4-amino-3-fluorophenyl)sulfinyl-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 81190997 |
| Molecular Formula | C11H15FN2O2S |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-(4-amino-3-fluorophenyl)sulfinyl-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCS(=O)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C11H15FN2O2S/c1-14(2)11(15)5-6-17(16)8-3-4-10(13)9(12)7-8/h3-4,7H,5-6,13H2,1-2H3 |
| InChIKey | MERZIBMIRQDCJN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|