C13H18ClNO2S — CID 116525458
5-chloro-2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline (PubChem CID 116525458) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is 5-chloro-2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline.
| Compound Name | 5-chloro-2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 116525458 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-chloro-2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline |
| SMILES | CC1(C)CCC(CS(=O)c2ccc(Cl)cc2N)O1 |
| InChI | InChI=1S/C13H18ClNO2S/c1-13(2)6-5-10(17-13)8-18(16)12-4-3-9(14)7-11(12)15/h3-4,7,10H,5-6,8,15H2,1-2H3 |
| InChIKey | OXONWBKOVUNQGO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|