C15H20BrNO2S — CID 102902925
5-bromo-2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfinyl)aniline (PubChem CID 102902925) has the molecular formula C15H20BrNO2S and a molecular weight of 358.30 g/mol. Its IUPAC name is 5-bromo-2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfinyl)aniline.
| Compound Name | 5-bromo-2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfinyl)aniline |
|---|---|
| PubChem CID | 102902925 |
| Molecular Formula | C15H20BrNO2S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 5-bromo-2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfinyl)aniline |
| SMILES | Nc1cc(Br)ccc1S(=O)CC1CCC2(CCCC2)O1 |
| InChI | InChI=1S/C15H20BrNO2S/c16-11-3-4-14(13(17)9-11)20(18)10-12-5-8-15(19-12)6-1-2-7-15/h3-4,9,12H,1-2,5-8,10,17H2 |
| InChIKey | CLZUFASDWVGZIQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|