About 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline
2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline (PubChem CID 116523298) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline.
Molecular Properties
| Compound Name | 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline |
| PubChem CID | 116523298 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline |
| SMILES | CC1(C)CCC(CS(=O)c2ccccc2N)O1 |
| InChI | InChI=1S/C13H19NO2S/c1-13(2)8-7-10(16-13)9-17(15)12-6-4-3-5-11(12)14/h3-6,10H,7-9,14H2,1-2H3 |
| InChIKey | YTCQBDIVTNSIPS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline?
The IUPAC name of 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline (CID 116523298) is 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline.
What is the SMILES notation for 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline?
The canonical SMILES for 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline is CC1(C)CCC(CS(=O)c2ccccc2N)O1.
What is the InChIKey of 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline?
The InChIKey is YTCQBDIVTNSIPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S/c1-13(2)8-7-10(16-13)9-17(15)12-6-4-3-5-11(12)14/h3-6,10H,7-9,14H2,1-2H3.
What are the key properties of 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline?
2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline has a molecular weight of 253.37 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline is sourced from PubChem (CID 116523298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).