C13H19NO2S — CID 116523298
2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline (PubChem CID 116523298) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline.
| Compound Name | 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 116523298 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[(5,5-dimethyloxolan-2-yl)methylsulfinyl]aniline |
| SMILES | CC1(C)CCC(CS(=O)c2ccccc2N)O1 |
| InChI | InChI=1S/C13H19NO2S/c1-13(2)8-7-10(16-13)9-17(15)12-6-4-3-5-11(12)14/h3-6,10H,7-9,14H2,1-2H3 |
| InChIKey | YTCQBDIVTNSIPS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|