C12H18N2O2 — CID 116521766
3-amino-1-[(5,5-dimethyloxolan-2-yl)methyl]pyridin-2-one (PubChem CID 116521766) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-amino-1-[(5,5-dimethyloxolan-2-yl)methyl]pyridin-2-one.
| Compound Name | 3-amino-1-[(5,5-dimethyloxolan-2-yl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 116521766 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-amino-1-[(5,5-dimethyloxolan-2-yl)methyl]pyridin-2-one |
| SMILES | CC1(C)CCC(Cn2cccc(N)c2=O)O1 |
| InChI | InChI=1S/C12H18N2O2/c1-12(2)6-5-9(16-12)8-14-7-3-4-10(13)11(14)15/h3-4,7,9H,5-6,8,13H2,1-2H3 |
| InChIKey | MGLKMZFFYLUVBN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |